C10H11ClFNO2 — CID 130520765
3-(2-chloro-4-fluoro-5-methylanilino)propanoic acid (PubChem CID 130520765) has the molecular formula C10H11ClFNO2 and a molecular weight of 231.65 g/mol. Its IUPAC name is 3-(2-chloro-4-fluoro-5-methylanilino)propanoic acid.
| Compound Name | 3-(2-chloro-4-fluoro-5-methylanilino)propanoic acid |
|---|---|
| PubChem CID | 130520765 |
| Molecular Formula | C10H11ClFNO2 |
| Molecular Weight | 231.65 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 3-(2-chloro-4-fluoro-5-methylanilino)propanoic acid |
| SMILES | Cc1cc(NCCC(=O)O)c(Cl)cc1F |
| InChI | InChI=1S/C10H11ClFNO2/c1-6-4-9(7(11)5-8(6)12)13-3-2-10(14)15/h4-5,13H,2-3H2,1H3,(H,14,15) |
| InChIKey | CVBPTCUQWPGMQE-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.65 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |