3,3-difluoro-3-(2,4,5-trimethylphenyl)propanoic acid

C12H14F2O2 — CID 116838380

IUPAC3,3-difluoro-3-(2,4,5-trimethylphenyl)propanoic acid
SMILESCc1cc(C)c(C(F)(F)CC(=O)O)cc1C
InChIInChI=1S/C12H14F2O2/c1-7-4-9(3)10(5-8(7)2)12(13,14)6-11(15)16/h4-5H,6H2,1-3H3,(H,15,16)
InChIKeyRSKJHBDARHOQGY-UHFFFAOYSA-N
MW228.24 g/mol
LogP3.18
Rot. Bonds3

About 3,3-difluoro-3-(2,4,5-trimethylphenyl)propanoic acid

3,3-difluoro-3-(2,4,5-trimethylphenyl)propanoic acid (PubChem CID 116838380) has the molecular formula C12H14F2O2 and a molecular weight of 228.24 g/mol. Its IUPAC name is 3,3-difluoro-3-(2,4,5-trimethylphenyl)propanoic acid.

Molecular Properties

Compound Name3,3-difluoro-3-(2,4,5-trimethylphenyl)propanoic acid
PubChem CID116838380
Molecular FormulaC12H14F2O2
Molecular Weight228.24 g/mol
Exact Mass228.10
IUPAC Name3,3-difluoro-3-(2,4,5-trimethylphenyl)propanoic acid
SMILESCc1cc(C)c(C(F)(F)CC(=O)O)cc1C
InChIInChI=1S/C12H14F2O2/c1-7-4-9(3)10(5-8(7)2)12(13,14)6-11(15)16/h4-5H,6H2,1-3H3,(H,15,16)
InChIKeyRSKJHBDARHOQGY-UHFFFAOYSA-N
XLogP3.18
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds3
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500228.24
LogP ≤ 53.18
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze 3,3-difluoro-3-(2,4,5-trimethylphenyl)propanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,3-difluoro-3-(2,4,5-trimethylphenyl)propanoic acid?
The IUPAC name of 3,3-difluoro-3-(2,4,5-trimethylphenyl)propanoic acid (CID 116838380) is 3,3-difluoro-3-(2,4,5-trimethylphenyl)propanoic acid.
What is the SMILES notation for 3,3-difluoro-3-(2,4,5-trimethylphenyl)propanoic acid?
The canonical SMILES for 3,3-difluoro-3-(2,4,5-trimethylphenyl)propanoic acid is Cc1cc(C)c(C(F)(F)CC(=O)O)cc1C.
What is the InChIKey of 3,3-difluoro-3-(2,4,5-trimethylphenyl)propanoic acid?
The InChIKey is RSKJHBDARHOQGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14F2O2/c1-7-4-9(3)10(5-8(7)2)12(13,14)6-11(15)16/h4-5H,6H2,1-3H3,(H,15,16).
What are the key properties of 3,3-difluoro-3-(2,4,5-trimethylphenyl)propanoic acid?
3,3-difluoro-3-(2,4,5-trimethylphenyl)propanoic acid has a molecular weight of 228.24 g/mol, XLogP of 3.18, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoro-3-(2,4,5-trimethylphenyl)propanoic acid is sourced from PubChem (CID 116838380), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).