C12H14F2O2 — CID 116838380
3,3-difluoro-3-(2,4,5-trimethylphenyl)propanoic acid (PubChem CID 116838380) has the molecular formula C12H14F2O2 and a molecular weight of 228.24 g/mol. Its IUPAC name is 3,3-difluoro-3-(2,4,5-trimethylphenyl)propanoic acid.
| Compound Name | 3,3-difluoro-3-(2,4,5-trimethylphenyl)propanoic acid |
|---|---|
| PubChem CID | 116838380 |
| Molecular Formula | C12H14F2O2 |
| Molecular Weight | 228.24 g/mol |
| Exact Mass | 228.10 |
| IUPAC Name | 3,3-difluoro-3-(2,4,5-trimethylphenyl)propanoic acid |
| SMILES | Cc1cc(C)c(C(F)(F)CC(=O)O)cc1C |
| InChI | InChI=1S/C12H14F2O2/c1-7-4-9(3)10(5-8(7)2)12(13,14)6-11(15)16/h4-5H,6H2,1-3H3,(H,15,16) |
| InChIKey | RSKJHBDARHOQGY-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.24 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |