C12H11F5O2 — CID 103303093
6,6-difluoro-6-(2,4,5-trifluorophenyl)hexanoic acid (PubChem CID 103303093) has the molecular formula C12H11F5O2 and a molecular weight of 282.21 g/mol. Its IUPAC name is 6,6-difluoro-6-(2,4,5-trifluorophenyl)hexanoic acid.
| Compound Name | 6,6-difluoro-6-(2,4,5-trifluorophenyl)hexanoic acid |
|---|---|
| PubChem CID | 103303093 |
| Molecular Formula | C12H11F5O2 |
| Molecular Weight | 282.21 g/mol |
| Exact Mass | 282.07 |
| IUPAC Name | 6,6-difluoro-6-(2,4,5-trifluorophenyl)hexanoic acid |
| SMILES | O=C(O)CCCCC(F)(F)c1cc(F)c(F)cc1F |
| InChI | InChI=1S/C12H11F5O2/c13-8-6-10(15)9(14)5-7(8)12(16,17)4-2-1-3-11(18)19/h5-6H,1-4H2,(H,18,19) |
| InChIKey | PJYPOLAVTPMVIE-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.21 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|