C15H21FO3 — CID 112519778
2-(4-ethoxy-3-fluorophenyl)-2,4-dimethylpentanoic acid (PubChem CID 112519778) has the molecular formula C15H21FO3 and a molecular weight of 268.33 g/mol. Its IUPAC name is 2-(4-ethoxy-3-fluorophenyl)-2,4-dimethylpentanoic acid.
| Compound Name | 2-(4-ethoxy-3-fluorophenyl)-2,4-dimethylpentanoic acid |
|---|---|
| PubChem CID | 112519778 |
| Molecular Formula | C15H21FO3 |
| Molecular Weight | 268.33 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | 2-(4-ethoxy-3-fluorophenyl)-2,4-dimethylpentanoic acid |
| SMILES | CCOc1ccc(C(C)(CC(C)C)C(=O)O)cc1F |
| InChI | InChI=1S/C15H21FO3/c1-5-19-13-7-6-11(8-12(13)16)15(4,14(17)18)9-10(2)3/h6-8,10H,5,9H2,1-4H3,(H,17,18) |
| InChIKey | KKPRWWWUXSZXCU-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |