2-(4-ethylsulfanylphenyl)-2,4-dimethylpentanoic acid

C15H22O2S — CID 112519746

IUPAC2-(4-ethylsulfanylphenyl)-2,4-dimethylpentanoic acid
SMILESCCSc1ccc(C(C)(CC(C)C)C(=O)O)cc1
InChIInChI=1S/C15H22O2S/c1-5-18-13-8-6-12(7-9-13)15(4,14(16)17)10-11(2)3/h6-9,11H,5,10H2,1-4H3,(H,16,17)
InChIKeyDARZUWAXRJYOHX-UHFFFAOYSA-N
MW266.41 g/mol
LogP4.19
Rot. Bonds6

About 2-(4-ethylsulfanylphenyl)-2,4-dimethylpentanoic acid

2-(4-ethylsulfanylphenyl)-2,4-dimethylpentanoic acid (PubChem CID 112519746) has the molecular formula C15H22O2S and a molecular weight of 266.41 g/mol. Its IUPAC name is 2-(4-ethylsulfanylphenyl)-2,4-dimethylpentanoic acid.

Molecular Properties

Compound Name2-(4-ethylsulfanylphenyl)-2,4-dimethylpentanoic acid
PubChem CID112519746
Molecular FormulaC15H22O2S
Molecular Weight266.41 g/mol
Exact Mass266.13
IUPAC Name2-(4-ethylsulfanylphenyl)-2,4-dimethylpentanoic acid
SMILESCCSc1ccc(C(C)(CC(C)C)C(=O)O)cc1
InChIInChI=1S/C15H22O2S/c1-5-18-13-8-6-12(7-9-13)15(4,14(16)17)10-11(2)3/h6-9,11H,5,10H2,1-4H3,(H,16,17)
InChIKeyDARZUWAXRJYOHX-UHFFFAOYSA-N
XLogP4.19
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds6
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500266.41
LogP ≤ 54.19
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 2-(4-ethylsulfanylphenyl)-2,4-dimethylpentanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-ethylsulfanylphenyl)-2,4-dimethylpentanoic acid?
The IUPAC name of 2-(4-ethylsulfanylphenyl)-2,4-dimethylpentanoic acid (CID 112519746) is 2-(4-ethylsulfanylphenyl)-2,4-dimethylpentanoic acid.
What is the SMILES notation for 2-(4-ethylsulfanylphenyl)-2,4-dimethylpentanoic acid?
The canonical SMILES for 2-(4-ethylsulfanylphenyl)-2,4-dimethylpentanoic acid is CCSc1ccc(C(C)(CC(C)C)C(=O)O)cc1.
What is the InChIKey of 2-(4-ethylsulfanylphenyl)-2,4-dimethylpentanoic acid?
The InChIKey is DARZUWAXRJYOHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H22O2S/c1-5-18-13-8-6-12(7-9-13)15(4,14(16)17)10-11(2)3/h6-9,11H,5,10H2,1-4H3,(H,16,17).
What are the key properties of 2-(4-ethylsulfanylphenyl)-2,4-dimethylpentanoic acid?
2-(4-ethylsulfanylphenyl)-2,4-dimethylpentanoic acid has a molecular weight of 266.41 g/mol, XLogP of 4.19, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-ethylsulfanylphenyl)-2,4-dimethylpentanoic acid is sourced from PubChem (CID 112519746), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).