About S-ethyl (2R)-3-(4-tert-butylphenyl)sulfanyl-2-methylpropanethioate
S-ethyl (2R)-3-(4-tert-butylphenyl)sulfanyl-2-methylpropanethioate (PubChem CID 10870202) has the molecular formula C16H24OS2
and a molecular weight of 296.50 g/mol. Its IUPAC name is S-ethyl (2R)-3-(4-tert-butylphenyl)sulfanyl-2-methylpropanethioate.
Molecular Properties
| Compound Name | S-ethyl (2R)-3-(4-tert-butylphenyl)sulfanyl-2-methylpropanethioate |
| PubChem CID | 10870202 |
| Molecular Formula | C16H24OS2 |
| Molecular Weight | 296.50 g/mol |
| Exact Mass | 296.13 |
| IUPAC Name | S-ethyl (2R)-3-(4-tert-butylphenyl)sulfanyl-2-methylpropanethioate |
| SMILES | CCSC(=O)[C@H](C)CSc1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C16H24OS2/c1-6-18-15(17)12(2)11-19-14-9-7-13(8-10-14)16(3,4)5/h7-10,12H,6,11H2,1-5H3/t12-/m1/s1 |
| InChIKey | YTCJVISXNHWWMA-GFCCVEGCSA-N |
| XLogP | 4.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.50 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-ethyl (2R)-3-(4-tert-butylphenyl)sulfanyl-2-methylpropanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-ethyl (2R)-3-(4-tert-butylphenyl)sulfanyl-2-methylpropanethioate?
The IUPAC name of S-ethyl (2R)-3-(4-tert-butylphenyl)sulfanyl-2-methylpropanethioate (CID 10870202) is S-ethyl (2R)-3-(4-tert-butylphenyl)sulfanyl-2-methylpropanethioate.
What is the SMILES notation for S-ethyl (2R)-3-(4-tert-butylphenyl)sulfanyl-2-methylpropanethioate?
The canonical SMILES for S-ethyl (2R)-3-(4-tert-butylphenyl)sulfanyl-2-methylpropanethioate is CCSC(=O)[C@H](C)CSc1ccc(C(C)(C)C)cc1.
What is the InChIKey of S-ethyl (2R)-3-(4-tert-butylphenyl)sulfanyl-2-methylpropanethioate?
The InChIKey is YTCJVISXNHWWMA-GFCCVEGCSA-N. The full InChI is InChI=1S/C16H24OS2/c1-6-18-15(17)12(2)11-19-14-9-7-13(8-10-14)16(3,4)5/h7-10,12H,6,11H2,1-5H3/t12-/m1/s1.
What are the key properties of S-ethyl (2R)-3-(4-tert-butylphenyl)sulfanyl-2-methylpropanethioate?
S-ethyl (2R)-3-(4-tert-butylphenyl)sulfanyl-2-methylpropanethioate has a molecular weight of 296.50 g/mol, XLogP of 4.99, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-ethyl (2R)-3-(4-tert-butylphenyl)sulfanyl-2-methylpropanethioate is sourced from PubChem (CID 10870202), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).