About S-ethyl (2S)-2-benzyl-3-(4-tert-butylphenyl)sulfanylpropanethioate
S-ethyl (2S)-2-benzyl-3-(4-tert-butylphenyl)sulfanylpropanethioate (PubChem CID 137322207) has the molecular formula C22H28OS2
and a molecular weight of 372.60 g/mol. Its IUPAC name is S-ethyl (2S)-2-benzyl-3-(4-tert-butylphenyl)sulfanylpropanethioate.
Molecular Properties
| Compound Name | S-ethyl (2S)-2-benzyl-3-(4-tert-butylphenyl)sulfanylpropanethioate |
| PubChem CID | 137322207 |
| Molecular Formula | C22H28OS2 |
| Molecular Weight | 372.60 g/mol |
| Exact Mass | 372.16 |
| IUPAC Name | S-ethyl (2S)-2-benzyl-3-(4-tert-butylphenyl)sulfanylpropanethioate |
| SMILES | CCSC(=O)C(CSc1ccc(C(C)(C)C)cc1)Cc1ccccc1 |
| InChI | InChI=1S/C22H28OS2/c1-5-24-21(23)18(15-17-9-7-6-8-10-17)16-25-20-13-11-19(12-14-20)22(2,3)4/h6-14,18H,5,15-16H2,1-4H3 |
| InChIKey | JSJLVPGNCHYRNQ-UHFFFAOYSA-N |
| XLogP | 6.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 372.60 |
| LogP ≤ 5 | 6.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|
Analyze S-ethyl (2S)-2-benzyl-3-(4-tert-butylphenyl)sulfanylpropanethioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of S-ethyl (2S)-2-benzyl-3-(4-tert-butylphenyl)sulfanylpropanethioate?
The IUPAC name of S-ethyl (2S)-2-benzyl-3-(4-tert-butylphenyl)sulfanylpropanethioate (CID 137322207) is S-ethyl (2S)-2-benzyl-3-(4-tert-butylphenyl)sulfanylpropanethioate.
What is the SMILES notation for S-ethyl (2S)-2-benzyl-3-(4-tert-butylphenyl)sulfanylpropanethioate?
The canonical SMILES for S-ethyl (2S)-2-benzyl-3-(4-tert-butylphenyl)sulfanylpropanethioate is CCSC(=O)C(CSc1ccc(C(C)(C)C)cc1)Cc1ccccc1.
What is the InChIKey of S-ethyl (2S)-2-benzyl-3-(4-tert-butylphenyl)sulfanylpropanethioate?
The InChIKey is JSJLVPGNCHYRNQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H28OS2/c1-5-24-21(23)18(15-17-9-7-6-8-10-17)16-25-20-13-11-19(12-14-20)22(2,3)4/h6-14,18H,5,15-16H2,1-4H3.
What are the key properties of S-ethyl (2S)-2-benzyl-3-(4-tert-butylphenyl)sulfanylpropanethioate?
S-ethyl (2S)-2-benzyl-3-(4-tert-butylphenyl)sulfanylpropanethioate has a molecular weight of 372.60 g/mol, XLogP of 6.21, 7 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for S-ethyl (2S)-2-benzyl-3-(4-tert-butylphenyl)sulfanylpropanethioate is sourced from PubChem (CID 137322207), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).