C13H17ClF2 — CID 107514442
1-(4-chloro-2-methylpentan-2-yl)-2,3-difluoro-4-methylbenzene (PubChem CID 107514442) has the molecular formula C13H17ClF2 and a molecular weight of 246.73 g/mol. Its IUPAC name is 1-(4-chloro-2-methylpentan-2-yl)-2,3-difluoro-4-methylbenzene.
| Compound Name | 1-(4-chloro-2-methylpentan-2-yl)-2,3-difluoro-4-methylbenzene |
|---|---|
| PubChem CID | 107514442 |
| Molecular Formula | C13H17ClF2 |
| Molecular Weight | 246.73 g/mol |
| Exact Mass | 246.10 |
| IUPAC Name | 1-(4-chloro-2-methylpentan-2-yl)-2,3-difluoro-4-methylbenzene |
| SMILES | Cc1ccc(C(C)(C)CC(C)Cl)c(F)c1F |
| InChI | InChI=1S/C13H17ClF2/c1-8-5-6-10(12(16)11(8)15)13(3,4)7-9(2)14/h5-6,9H,7H2,1-4H3 |
| InChIKey | NXDZUCOYEPADMJ-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.73 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|