C13H20O — CID 94334038
(2S)-2-(3,4-dimethylphenyl)-3-methylbutan-2-ol (PubChem CID 94334038) has the molecular formula C13H20O and a molecular weight of 192.30 g/mol. Its IUPAC name is (2S)-2-(3,4-dimethylphenyl)-3-methylbutan-2-ol.
| Compound Name | (2S)-2-(3,4-dimethylphenyl)-3-methylbutan-2-ol |
|---|---|
| PubChem CID | 94334038 |
| Molecular Formula | C13H20O |
| Molecular Weight | 192.30 g/mol |
| Exact Mass | 192.15 |
| IUPAC Name | (2S)-2-(3,4-dimethylphenyl)-3-methylbutan-2-ol |
| SMILES | Cc1ccc([C@@](C)(O)C(C)C)cc1C |
| InChI | InChI=1S/C13H20O/c1-9(2)13(5,14)12-7-6-10(3)11(4)8-12/h6-9,14H,1-5H3/t13-/m0/s1 |
| InChIKey | RRVJCJCLFWFLDE-ZDUSSCGKSA-N |
| XLogP | 3.17 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.30 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |