About methyl 3-(3,4-dimethylphenyl)-3-hydroxy-2-propan-2-ylbutanoate
methyl 3-(3,4-dimethylphenyl)-3-hydroxy-2-propan-2-ylbutanoate (PubChem CID 62395949) has the molecular formula C16H24O3
and a molecular weight of 264.37 g/mol. Its IUPAC name is methyl 3-(3,4-dimethylphenyl)-3-hydroxy-2-propan-2-ylbutanoate.
Analyze methyl 3-(3,4-dimethylphenyl)-3-hydroxy-2-propan-2-ylbutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(3,4-dimethylphenyl)-3-hydroxy-2-propan-2-ylbutanoate?
The IUPAC name of methyl 3-(3,4-dimethylphenyl)-3-hydroxy-2-propan-2-ylbutanoate (CID 62395949) is methyl 3-(3,4-dimethylphenyl)-3-hydroxy-2-propan-2-ylbutanoate.
What is the SMILES notation for methyl 3-(3,4-dimethylphenyl)-3-hydroxy-2-propan-2-ylbutanoate?
The canonical SMILES for methyl 3-(3,4-dimethylphenyl)-3-hydroxy-2-propan-2-ylbutanoate is COC(=O)C(C(C)C)C(C)(O)c1ccc(C)c(C)c1.
What is the InChIKey of methyl 3-(3,4-dimethylphenyl)-3-hydroxy-2-propan-2-ylbutanoate?
The InChIKey is FCOISMNUEICXPO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H24O3/c1-10(2)14(15(17)19-6)16(5,18)13-8-7-11(3)12(4)9-13/h7-10,14,18H,1-6H3.
What are the key properties of methyl 3-(3,4-dimethylphenyl)-3-hydroxy-2-propan-2-ylbutanoate?
methyl 3-(3,4-dimethylphenyl)-3-hydroxy-2-propan-2-ylbutanoate has a molecular weight of 264.37 g/mol, XLogP of 2.96, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3,4-dimethylphenyl)-3-hydroxy-2-propan-2-ylbutanoate is sourced from PubChem (CID 62395949), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).