C17H8F6N2O6 — CID 14618051
1-[3,3,4,4,5,5-hexafluoro-2-(3-nitrophenoxy)cyclopenten-1-yl]oxy-3-nitrobenzene (PubChem CID 14618051) has the molecular formula C17H8F6N2O6 and a molecular weight of 450.25 g/mol. Its IUPAC name is 1-[3,3,4,4,5,5-hexafluoro-2-(3-nitrophenoxy)cyclopenten-1-yl]oxy-3-nitrobenzene.
| Compound Name | 1-[3,3,4,4,5,5-hexafluoro-2-(3-nitrophenoxy)cyclopenten-1-yl]oxy-3-nitrobenzene |
|---|---|
| PubChem CID | 14618051 |
| Molecular Formula | C17H8F6N2O6 |
| Molecular Weight | 450.25 g/mol |
| Exact Mass | 450.03 |
| IUPAC Name | 1-[3,3,4,4,5,5-hexafluoro-2-(3-nitrophenoxy)cyclopenten-1-yl]oxy-3-nitrobenzene |
| SMILES | O=[N+]([O-])c1cccc(OC2=C(Oc3cccc([N+](=O)[O-])c3)C(F)(F)C(F)(F)C2(F)F)c1 |
| InChI | InChI=1S/C17H8F6N2O6/c18-15(19)13(30-11-5-1-3-9(7-11)24(26)27)14(16(20,21)17(15,22)23)31-12-6-2-4-10(8-12)25(28)29/h1-8H |
| InChIKey | XSPOSKZRZWEKCX-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 104.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.25 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|