About 3-methylphenol thiocyanate
3-methylphenol thiocyanate (PubChem CID 20976814) has the molecular formula C8H8NOS-
and a molecular weight of 166.22 g/mol. Its IUPAC name is 3-methylphenol thiocyanate.
Molecular Properties
| Compound Name | 3-methylphenol thiocyanate |
| PubChem CID | 20976814 |
| Molecular Formula | C8H8NOS- |
| Molecular Weight | 166.22 g/mol |
| Exact Mass | 166.03 |
| IUPAC Name | 3-methylphenol thiocyanate |
| SMILES | Cc1cccc(O)c1.N#C[S-] |
| InChI | InChI=1S/C7H8O.CHNS/c1-6-3-2-4-7(8)5-6;2-1-3/h2-5,8H,1H3;3H/p-1 |
| InChIKey | CQPSIYOPTNHIKR-UHFFFAOYSA-M |
| XLogP | 1.72 |
| TPSA | 44.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.22 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze 3-methylphenol thiocyanate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methylphenol thiocyanate?
The IUPAC name of 3-methylphenol thiocyanate (CID 20976814) is 3-methylphenol thiocyanate.
What is the SMILES notation for 3-methylphenol thiocyanate?
The canonical SMILES for 3-methylphenol thiocyanate is Cc1cccc(O)c1.N#C[S-].
What is the InChIKey of 3-methylphenol thiocyanate?
The InChIKey is CQPSIYOPTNHIKR-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H8O.CHNS/c1-6-3-2-4-7(8)5-6;2-1-3/h2-5,8H,1H3;3H/p-1.
What are the key properties of 3-methylphenol thiocyanate?
3-methylphenol thiocyanate has a molecular weight of 166.22 g/mol, XLogP of 1.72, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methylphenol thiocyanate is sourced from PubChem (CID 20976814), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).