C11H15MoN3O3 — CID 161308535
molybdenum;pentane-2,4-dione;pyridine-4-carbohydrazide (PubChem CID 161308535) has the molecular formula C11H15MoN3O3 and a molecular weight of 333.20 g/mol. Its IUPAC name is molybdenum;pentane-2,4-dione;pyridine-4-carbohydrazide.
| Compound Name | molybdenum;pentane-2,4-dione;pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 161308535 |
| Molecular Formula | C11H15MoN3O3 |
| Molecular Weight | 333.20 g/mol |
| Exact Mass | 335.02 |
| IUPAC Name | molybdenum;pentane-2,4-dione;pyridine-4-carbohydrazide |
| SMILES | CC(=O)CC(C)=O.NNC(=O)c1ccncc1.[Mo] |
| InChI | InChI=1S/C6H7N3O.C5H8O2.Mo/c7-9-6(10)5-1-3-8-4-2-5;1-4(6)3-5(2)7;/h1-4H,7H2,(H,9,10);3H2,1-2H3; |
| InChIKey | VIOUBJCMCCHDNP-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 102.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.20 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|