About 2-hydroxybenzaldehyde;pyridine-4-carbohydrazide
2-hydroxybenzaldehyde;pyridine-4-carbohydrazide (PubChem CID 90002677) has the molecular formula C13H13N3O3
and a molecular weight of 259.27 g/mol. Its IUPAC name is 2-hydroxybenzaldehyde;pyridine-4-carbohydrazide.
Molecular Properties
| Compound Name | 2-hydroxybenzaldehyde;pyridine-4-carbohydrazide |
| PubChem CID | 90002677 |
| Molecular Formula | C13H13N3O3 |
| Molecular Weight | 259.27 g/mol |
| Exact Mass | 259.10 |
| IUPAC Name | 2-hydroxybenzaldehyde;pyridine-4-carbohydrazide |
| SMILES | NNC(=O)c1ccncc1.O=Cc1ccccc1O |
| InChI | InChI=1S/C7H6O2.C6H7N3O/c8-5-6-3-1-2-4-7(6)9;7-9-6(10)5-1-3-8-4-2-5/h1-5,9H;1-4H,7H2,(H,9,10) |
| InChIKey | OGWOMSANEWBACU-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 105.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.27 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-hydroxybenzaldehyde;pyridine-4-carbohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-hydroxybenzaldehyde;pyridine-4-carbohydrazide?
The IUPAC name of 2-hydroxybenzaldehyde;pyridine-4-carbohydrazide (CID 90002677) is 2-hydroxybenzaldehyde;pyridine-4-carbohydrazide.
What is the SMILES notation for 2-hydroxybenzaldehyde;pyridine-4-carbohydrazide?
The canonical SMILES for 2-hydroxybenzaldehyde;pyridine-4-carbohydrazide is NNC(=O)c1ccncc1.O=Cc1ccccc1O.
What is the InChIKey of 2-hydroxybenzaldehyde;pyridine-4-carbohydrazide?
The InChIKey is OGWOMSANEWBACU-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H6O2.C6H7N3O/c8-5-6-3-1-2-4-7(6)9;7-9-6(10)5-1-3-8-4-2-5/h1-5,9H;1-4H,7H2,(H,9,10).
What are the key properties of 2-hydroxybenzaldehyde;pyridine-4-carbohydrazide?
2-hydroxybenzaldehyde;pyridine-4-carbohydrazide has a molecular weight of 259.27 g/mol, XLogP of 0.89, 2 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-hydroxybenzaldehyde;pyridine-4-carbohydrazide is sourced from PubChem (CID 90002677), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).