C16H24N4O2 — CID 144925725
(4Z)-4-ethenylhepta-4,6-dien-1-amine;formaldehyde;pyridine-4-carbohydrazide (PubChem CID 144925725) has the molecular formula C16H24N4O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is (4Z)-4-ethenylhepta-4,6-dien-1-amine;formaldehyde;pyridine-4-carbohydrazide.
| Compound Name | (4Z)-4-ethenylhepta-4,6-dien-1-amine;formaldehyde;pyridine-4-carbohydrazide |
|---|---|
| PubChem CID | 144925725 |
| Molecular Formula | C16H24N4O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.19 |
| IUPAC Name | (4Z)-4-ethenylhepta-4,6-dien-1-amine;formaldehyde;pyridine-4-carbohydrazide |
| SMILES | C=C/C=C(\C=C)CCCN.C=O.NNC(=O)c1ccncc1 |
| InChI | InChI=1S/C9H15N.C6H7N3O.CH2O/c1-3-6-9(4-2)7-5-8-10;7-9-6(10)5-1-3-8-4-2-5;1-2/h3-4,6H,1-2,5,7-8,10H2;1-4H,7H2,(H,9,10);1H2/b9-6+;; |
| InChIKey | FTSZCZMBNKRKDS-SWSRPJROSA-N |
| XLogP | 1.52 |
| TPSA | 111.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|