About ethane;2-methoxy-2-oxoacetic acid
ethane;2-methoxy-2-oxoacetic acid (PubChem CID 175061457) has the molecular formula C5H10O4
and a molecular weight of 134.13 g/mol. Its IUPAC name is ethane;2-methoxy-2-oxoacetic acid.
Molecular Properties
| Compound Name | ethane;2-methoxy-2-oxoacetic acid |
| PubChem CID | 175061457 |
| Molecular Formula | C5H10O4 |
| Molecular Weight | 134.13 g/mol |
| Exact Mass | 134.06 |
| IUPAC Name | ethane;2-methoxy-2-oxoacetic acid |
| SMILES | CC.COC(=O)C(=O)O |
| InChI | InChI=1S/C3H4O4.C2H6/c1-7-3(6)2(4)5;1-2/h1H3,(H,4,5);1-2H3 |
| InChIKey | OJSFCOYNQVQSFU-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.13 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze ethane;2-methoxy-2-oxoacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;2-methoxy-2-oxoacetic acid?
The IUPAC name of ethane;2-methoxy-2-oxoacetic acid (CID 175061457) is ethane;2-methoxy-2-oxoacetic acid.
What is the SMILES notation for ethane;2-methoxy-2-oxoacetic acid?
The canonical SMILES for ethane;2-methoxy-2-oxoacetic acid is CC.COC(=O)C(=O)O.
What is the InChIKey of ethane;2-methoxy-2-oxoacetic acid?
The InChIKey is OJSFCOYNQVQSFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4O4.C2H6/c1-7-3(6)2(4)5;1-2/h1H3,(H,4,5);1-2H3.
What are the key properties of ethane;2-methoxy-2-oxoacetic acid?
ethane;2-methoxy-2-oxoacetic acid has a molecular weight of 134.13 g/mol, XLogP of 0.27, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;2-methoxy-2-oxoacetic acid is sourced from PubChem (CID 175061457), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).