C15H16O7 — CID 141075872
(Z)-4-[4-(4-hydroxyphenoxy)-4-oxobutoxy]-3-methyl-4-oxobut-2-enoic acid (PubChem CID 141075872) has the molecular formula C15H16O7 and a molecular weight of 308.29 g/mol. Its IUPAC name is (Z)-4-[4-(4-hydroxyphenoxy)-4-oxobutoxy]-3-methyl-4-oxobut-2-enoic acid.
| Compound Name | (Z)-4-[4-(4-hydroxyphenoxy)-4-oxobutoxy]-3-methyl-4-oxobut-2-enoic acid |
|---|---|
| PubChem CID | 141075872 |
| Molecular Formula | C15H16O7 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | (Z)-4-[4-(4-hydroxyphenoxy)-4-oxobutoxy]-3-methyl-4-oxobut-2-enoic acid |
| SMILES | C/C(=C/C(=O)O)C(=O)OCCCC(=O)Oc1ccc(O)cc1 |
| InChI | InChI=1S/C15H16O7/c1-10(9-13(17)18)15(20)21-8-2-3-14(19)22-12-6-4-11(16)5-7-12/h4-7,9,16H,2-3,8H2,1H3,(H,17,18)/b10-9- |
| InChIKey | PWMIQPIAMHQGSS-KTKRTIGZSA-N |
| XLogP | 1.65 |
| TPSA | 110.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|