C40H38O8 — CID 68949382
3-[4-[3-(2-methyl-3-naphthalen-1-yloxyprop-2-enoyl)oxypropoxy]phenoxy]propyl 2-methyl-3-naphthalen-1-yloxyprop-2-enoate (PubChem CID 68949382) has the molecular formula C40H38O8 and a molecular weight of 646.74 g/mol. Its IUPAC name is 3-[4-[3-(2-methyl-3-naphthalen-1-yloxyprop-2-enoyl)oxypropoxy]phenoxy]propyl 2-methyl-3-naphthalen-1-yloxyprop-2-enoate.
| Compound Name | 3-[4-[3-(2-methyl-3-naphthalen-1-yloxyprop-2-enoyl)oxypropoxy]phenoxy]propyl 2-methyl-3-naphthalen-1-yloxyprop-2-enoate |
|---|---|
| PubChem CID | 68949382 |
| Molecular Formula | C40H38O8 |
| Molecular Weight | 646.74 g/mol |
| Exact Mass | 646.26 |
| IUPAC Name | 3-[4-[3-(2-methyl-3-naphthalen-1-yloxyprop-2-enoyl)oxypropoxy]phenoxy]propyl 2-methyl-3-naphthalen-1-yloxyprop-2-enoate |
| SMILES | CC(=COc1cccc2ccccc12)C(=O)OCCCOc1ccc(OCCCOC(=O)C(C)=COc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C40H38O8/c1-29(27-47-37-17-7-13-31-11-3-5-15-35(31)37)39(41)45-25-9-23-43-33-19-21-34(22-20-33)44-24-10-26-46-40(42)30(2)28-48-38-18-8-14-32-12-4-6-16-36(32)38/h3-8,11-22,27-28H,9-10,23-26H2,1-2H3 |
| InChIKey | NGYLDTVHNRAGEW-UHFFFAOYSA-N |
| XLogP | 8.58 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.74 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|