C45H44O9 — CID 68951964
3-[4-methoxy-2-[3-[2-methyl-3-(4-phenylphenoxy)prop-2-enoyl]oxypropoxy]phenoxy]propyl 2-methyl-3-(4-phenylphenoxy)prop-2-enoate (PubChem CID 68951964) has the molecular formula C45H44O9 and a molecular weight of 728.84 g/mol. Its IUPAC name is 3-[4-methoxy-2-[3-[2-methyl-3-(4-phenylphenoxy)prop-2-enoyl]oxypropoxy]phenoxy]propyl 2-methyl-3-(4-phenylphenoxy)prop-2-enoate.
| Compound Name | 3-[4-methoxy-2-[3-[2-methyl-3-(4-phenylphenoxy)prop-2-enoyl]oxypropoxy]phenoxy]propyl 2-methyl-3-(4-phenylphenoxy)prop-2-enoate |
|---|---|
| PubChem CID | 68951964 |
| Molecular Formula | C45H44O9 |
| Molecular Weight | 728.84 g/mol |
| Exact Mass | 728.30 |
| IUPAC Name | 3-[4-methoxy-2-[3-[2-methyl-3-(4-phenylphenoxy)prop-2-enoyl]oxypropoxy]phenoxy]propyl 2-methyl-3-(4-phenylphenoxy)prop-2-enoate |
| SMILES | COc1ccc(OCCCOC(=O)C(C)=COc2ccc(-c3ccccc3)cc2)c(OCCCOC(=O)C(C)=COc2ccc(-c3ccccc3)cc2)c1 |
| InChI | InChI=1S/C45H44O9/c1-33(31-53-39-20-16-37(17-21-39)35-12-6-4-7-13-35)44(46)51-28-10-26-49-42-25-24-41(48-3)30-43(42)50-27-11-29-52-45(47)34(2)32-54-40-22-18-38(19-23-40)36-14-8-5-9-15-36/h4-9,12-25,30-32H,10-11,26-29H2,1-3H3 |
| InChIKey | UKSACXAINNAHEL-UHFFFAOYSA-N |
| XLogP | 9.62 |
| TPSA | 98.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 54 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.84 |
| LogP ≤ 5 | 9.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|