C45H44O8 — CID 68951764
3-[3-methyl-2-[3-[2-methyl-3-(4-phenylphenoxy)prop-2-enoyl]oxypropoxy]phenoxy]propyl 2-methyl-3-(4-phenylphenoxy)prop-2-enoate (PubChem CID 68951764) has the molecular formula C45H44O8 and a molecular weight of 712.84 g/mol. Its IUPAC name is 3-[3-methyl-2-[3-[2-methyl-3-(4-phenylphenoxy)prop-2-enoyl]oxypropoxy]phenoxy]propyl 2-methyl-3-(4-phenylphenoxy)prop-2-enoate.
| Compound Name | 3-[3-methyl-2-[3-[2-methyl-3-(4-phenylphenoxy)prop-2-enoyl]oxypropoxy]phenoxy]propyl 2-methyl-3-(4-phenylphenoxy)prop-2-enoate |
|---|---|
| PubChem CID | 68951764 |
| Molecular Formula | C45H44O8 |
| Molecular Weight | 712.84 g/mol |
| Exact Mass | 712.30 |
| IUPAC Name | 3-[3-methyl-2-[3-[2-methyl-3-(4-phenylphenoxy)prop-2-enoyl]oxypropoxy]phenoxy]propyl 2-methyl-3-(4-phenylphenoxy)prop-2-enoate |
| SMILES | CC(=COc1ccc(-c2ccccc2)cc1)C(=O)OCCCOc1cccc(C)c1OCCCOC(=O)C(C)=COc1ccc(-c2ccccc2)cc1 |
| InChI | InChI=1S/C45H44O8/c1-33-13-10-18-42(48-27-11-29-50-44(46)34(2)31-52-40-23-19-38(20-24-40)36-14-6-4-7-15-36)43(33)49-28-12-30-51-45(47)35(3)32-53-41-25-21-39(22-26-41)37-16-8-5-9-17-37/h4-10,13-26,31-32H,11-12,27-30H2,1-3H3 |
| InChIKey | WAMFHTQMYLYNRN-UHFFFAOYSA-N |
| XLogP | 9.92 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 712.84 |
| LogP ≤ 5 | 9.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|