C21H32O5 — CID 155091866
[2-hydroxy-2-(6-phenoxyhexoxymethyl)butyl] 2-methylprop-2-enoate (PubChem CID 155091866) has the molecular formula C21H32O5 and a molecular weight of 364.48 g/mol. Its IUPAC name is [2-hydroxy-2-(6-phenoxyhexoxymethyl)butyl] 2-methylprop-2-enoate.
| Compound Name | [2-hydroxy-2-(6-phenoxyhexoxymethyl)butyl] 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 155091866 |
| Molecular Formula | C21H32O5 |
| Molecular Weight | 364.48 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | [2-hydroxy-2-(6-phenoxyhexoxymethyl)butyl] 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCC(O)(CC)COCCCCCCOc1ccccc1 |
| InChI | InChI=1S/C21H32O5/c1-4-21(23,17-26-20(22)18(2)3)16-24-14-10-5-6-11-15-25-19-12-8-7-9-13-19/h7-9,12-13,23H,2,4-6,10-11,14-17H2,1,3H3 |
| InChIKey | RVLPPMKCFBLGDL-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.48 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|