C41H50N4O5 — CID 59645603
10-[4-[[2-[(4-ethoxyphenoxy)methyl]-2-methyl-1,3-dihydroperimidin-6-yl]diazenyl]phenoxy]decyl 2-methylprop-2-enoate (PubChem CID 59645603) has the molecular formula C41H50N4O5 and a molecular weight of 678.87 g/mol. Its IUPAC name is 10-[4-[[2-[(4-ethoxyphenoxy)methyl]-2-methyl-1,3-dihydroperimidin-6-yl]diazenyl]phenoxy]decyl 2-methylprop-2-enoate.
| Compound Name | 10-[4-[[2-[(4-ethoxyphenoxy)methyl]-2-methyl-1,3-dihydroperimidin-6-yl]diazenyl]phenoxy]decyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59645603 |
| Molecular Formula | C41H50N4O5 |
| Molecular Weight | 678.87 g/mol |
| Exact Mass | 678.38 |
| IUPAC Name | 10-[4-[[2-[(4-ethoxyphenoxy)methyl]-2-methyl-1,3-dihydroperimidin-6-yl]diazenyl]phenoxy]decyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCCCCCOc1ccc(/N=N/c2ccc3c4c(cccc24)NC(C)(COc2ccc(OCC)cc2)N3)cc1 |
| InChI | InChI=1S/C41H50N4O5/c1-5-47-32-21-23-34(24-22-32)50-29-41(4)42-37-16-14-15-35-36(25-26-38(43-41)39(35)37)45-44-31-17-19-33(20-18-31)48-27-12-10-8-6-7-9-11-13-28-49-40(46)30(2)3/h14-26,42-43H,2,5-13,27-29H2,1,3-4H3/b45-44+ |
| InChIKey | CUGZVTWEAVHFLP-JQOKOOLQSA-N |
| XLogP | 10.91 |
| TPSA | 102.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 678.87 |
| LogP ≤ 5 | 10.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'naphth_amino_B(25)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|