C47H62N4O5 — CID 59513150
10-[4-[[2-methyl-2-[[4-(2,2,3,3-tetramethylbutoxy)phenoxy]methyl]-1,3-dihydroperimidin-6-yl]diazenyl]phenoxy]decyl 2-methylprop-2-enoate (PubChem CID 59513150) has the molecular formula C47H62N4O5 and a molecular weight of 763.04 g/mol. Its IUPAC name is 10-[4-[[2-methyl-2-[[4-(2,2,3,3-tetramethylbutoxy)phenoxy]methyl]-1,3-dihydroperimidin-6-yl]diazenyl]phenoxy]decyl 2-methylprop-2-enoate.
| Compound Name | 10-[4-[[2-methyl-2-[[4-(2,2,3,3-tetramethylbutoxy)phenoxy]methyl]-1,3-dihydroperimidin-6-yl]diazenyl]phenoxy]decyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 59513150 |
| Molecular Formula | C47H62N4O5 |
| Molecular Weight | 763.04 g/mol |
| Exact Mass | 762.47 |
| IUPAC Name | 10-[4-[[2-methyl-2-[[4-(2,2,3,3-tetramethylbutoxy)phenoxy]methyl]-1,3-dihydroperimidin-6-yl]diazenyl]phenoxy]decyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCCCCCCOc1ccc(/N=N/c2ccc3c4c(cccc24)NC(C)(COc2ccc(OCC(C)(C)C(C)(C)C)cc2)N3)cc1 |
| InChI | InChI=1S/C47H62N4O5/c1-34(2)44(52)54-31-16-14-12-10-9-11-13-15-30-53-36-22-20-35(21-23-36)50-51-40-28-29-42-43-39(40)18-17-19-41(43)48-47(8,49-42)33-56-38-26-24-37(25-27-38)55-32-46(6,7)45(3,4)5/h17-29,48-49H,1,9-16,30-33H2,2-8H3/b51-50+ |
| InChIKey | YQYQMPDYEJWSJN-VPWQGRENSA-N |
| XLogP | 12.96 |
| TPSA | 102.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 763.04 |
| LogP ≤ 5 | 12.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'naphth_amino_B(25)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|