C38H41N7O2 — CID 171843319
2-[4-[[4-[(2,2-dimethyl-1,3-dihydroperimidin-6-yl)diazenyl]naphthalen-1-yl]diazenyl]phenyl]ethyl 6-(methylamino)hexanoate (PubChem CID 171843319) has the molecular formula C38H41N7O2 and a molecular weight of 627.79 g/mol. Its IUPAC name is 2-[4-[[4-[(2,2-dimethyl-1,3-dihydroperimidin-6-yl)diazenyl]naphthalen-1-yl]diazenyl]phenyl]ethyl 6-(methylamino)hexanoate.
| Compound Name | 2-[4-[[4-[(2,2-dimethyl-1,3-dihydroperimidin-6-yl)diazenyl]naphthalen-1-yl]diazenyl]phenyl]ethyl 6-(methylamino)hexanoate |
|---|---|
| PubChem CID | 171843319 |
| Molecular Formula | C38H41N7O2 |
| Molecular Weight | 627.79 g/mol |
| Exact Mass | 627.33 |
| IUPAC Name | 2-[4-[[4-[(2,2-dimethyl-1,3-dihydroperimidin-6-yl)diazenyl]naphthalen-1-yl]diazenyl]phenyl]ethyl 6-(methylamino)hexanoate |
| SMILES | CNCCCCCC(=O)OCCc1ccc(/N=N/c2ccc(/N=N/c3ccc4c5c(cccc35)NC(C)(C)N4)c3ccccc23)cc1 |
| InChI | InChI=1S/C38H41N7O2/c1-38(2)40-34-13-9-12-30-33(21-22-35(41-38)37(30)34)45-44-32-20-19-31(28-10-6-7-11-29(28)32)43-42-27-17-15-26(16-18-27)23-25-47-36(46)14-5-4-8-24-39-3/h6-7,9-13,15-22,39-41H,4-5,8,14,23-25H2,1-3H3/b43-42+,45-44+ |
| InChIKey | XBNMIOFKZMWGHI-NITPHVIHSA-N |
| XLogP | 10.26 |
| TPSA | 111.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.79 |
| LogP ≤ 5 | 10.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'naphth_amino_B(25)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|