C41H44N8O3S — CID 145428606
(3aS)-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one;3-[2-methyl-6-[(4-phenyldiazenylnaphthalen-1-yl)diazenyl]-1,3-dihydroperimidin-2-yl]propyl pentanoate (PubChem CID 145428606) has the molecular formula C41H44N8O3S and a molecular weight of 728.92 g/mol. Its IUPAC name is (3aS)-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one;3-[2-methyl-6-[(4-phenyldiazenylnaphthalen-1-yl)diazenyl]-1,3-dihydroperimidin-2-yl]propyl pentanoate.
| Compound Name | (3aS)-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one;3-[2-methyl-6-[(4-phenyldiazenylnaphthalen-1-yl)diazenyl]-1,3-dihydroperimidin-2-yl]propyl pentanoate |
|---|---|
| PubChem CID | 145428606 |
| Molecular Formula | C41H44N8O3S |
| Molecular Weight | 728.92 g/mol |
| Exact Mass | 728.33 |
| IUPAC Name | (3aS)-1,3,3a,4,6,6a-hexahydrothieno[3,4-d]imidazol-2-one;3-[2-methyl-6-[(4-phenyldiazenylnaphthalen-1-yl)diazenyl]-1,3-dihydroperimidin-2-yl]propyl pentanoate |
| SMILES | CCCCC(=O)OCCCC1(C)Nc2cccc3c(/N=N/c4ccc(/N=N/c5ccccc5)c5ccccc45)ccc(c23)N1.O=C1NC2CSC[C@H]2N1 |
| InChI | InChI=1S/C36H36N6O2.C5H8N2OS/c1-3-4-18-34(43)44-24-11-23-36(2)37-32-17-10-16-28-31(21-22-33(38-36)35(28)32)42-41-30-20-19-29(26-14-8-9-15-27(26)30)40-39-25-12-6-5-7-13-25;8-5-6-3-1-9-2-4(3)7-5/h5-10,12-17,19-22,37-38H,3-4,11,18,23-24H2,1-2H3;3-4H,1-2H2,(H2,6,7,8)/b40-39+,42-41+;/t;3-,4?/m.1/s1 |
| InChIKey | UPAMHGQIRVDXCY-UXXRKBOQSA-N |
| XLogP | 10.67 |
| TPSA | 140.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.92 |
| LogP ≤ 5 | 10.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'naphth_amino_B(25)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'biotin_analogue', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|