C42H50N4O6-2 — CID 21135123
2-[2,2-bis(hexanoyloxymethyl)-1,3-dihydroperimidin-6-yl]-4-(2,2-dimethyl-1,3-dihydroperimidin-6-yl)cyclobutane-1,3-diolate (PubChem CID 21135123) has the molecular formula C42H50N4O6-2 and a molecular weight of 706.88 g/mol. Its IUPAC name is 2-[2,2-bis(hexanoyloxymethyl)-1,3-dihydroperimidin-6-yl]-4-(2,2-dimethyl-1,3-dihydroperimidin-6-yl)cyclobutane-1,3-diolate.
| Compound Name | 2-[2,2-bis(hexanoyloxymethyl)-1,3-dihydroperimidin-6-yl]-4-(2,2-dimethyl-1,3-dihydroperimidin-6-yl)cyclobutane-1,3-diolate |
|---|---|
| PubChem CID | 21135123 |
| Molecular Formula | C42H50N4O6-2 |
| Molecular Weight | 706.88 g/mol |
| Exact Mass | 706.37 |
| IUPAC Name | 2-[2,2-bis(hexanoyloxymethyl)-1,3-dihydroperimidin-6-yl]-4-(2,2-dimethyl-1,3-dihydroperimidin-6-yl)cyclobutane-1,3-diolate |
| SMILES | CCCCCC(=O)OCC1(COC(=O)CCCCC)Nc2cccc3c(C4C([O-])C(c5ccc6c7c(cccc57)NC(C)(C)N6)C4[O-])ccc(c23)N1 |
| InChI | InChI=1S/C42H50N4O6/c1-5-7-9-17-33(47)51-23-42(24-52-34(48)18-10-8-6-2)45-30-16-12-14-26-28(20-22-32(46-42)36(26)30)38-39(49)37(40(38)50)27-19-21-31-35-25(27)13-11-15-29(35)43-41(3,4)44-31/h11-16,19-22,37-40,43-46H,5-10,17-18,23-24H2,1-4H3/q-2 |
| InChIKey | CUXIFWWSTORXNU-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 146.84 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.88 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'naphth_amino_B(25)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|