C40H45N7O2 — CID 177106179
2-[4-[[4-[(2,2-dimethyl-1,3-dihydroperimidin-6-yl)diazenyl]naphthalen-1-yl]diazenyl]phenyl]ethyl 6-(propan-2-ylamino)hexanoate (PubChem CID 177106179) has the molecular formula C40H45N7O2 and a molecular weight of 655.85 g/mol. Its IUPAC name is 2-[4-[[4-[(2,2-dimethyl-1,3-dihydroperimidin-6-yl)diazenyl]naphthalen-1-yl]diazenyl]phenyl]ethyl 6-(propan-2-ylamino)hexanoate.
| Compound Name | 2-[4-[[4-[(2,2-dimethyl-1,3-dihydroperimidin-6-yl)diazenyl]naphthalen-1-yl]diazenyl]phenyl]ethyl 6-(propan-2-ylamino)hexanoate |
|---|---|
| PubChem CID | 177106179 |
| Molecular Formula | C40H45N7O2 |
| Molecular Weight | 655.85 g/mol |
| Exact Mass | 655.36 |
| IUPAC Name | 2-[4-[[4-[(2,2-dimethyl-1,3-dihydroperimidin-6-yl)diazenyl]naphthalen-1-yl]diazenyl]phenyl]ethyl 6-(propan-2-ylamino)hexanoate |
| SMILES | CC(C)NCCCCCC(=O)OCCc1ccc(/N=N/c2ccc(/N=N/c3ccc4c5c(cccc35)NC(C)(C)N4)c3ccccc23)cc1 |
| InChI | InChI=1S/C40H45N7O2/c1-27(2)41-25-9-5-6-15-38(48)49-26-24-28-16-18-29(19-17-28)44-45-33-20-21-34(31-12-8-7-11-30(31)33)46-47-35-22-23-37-39-32(35)13-10-14-36(39)42-40(3,4)43-37/h7-8,10-14,16-23,27,41-43H,5-6,9,15,24-26H2,1-4H3/b45-44+,47-46+ |
| InChIKey | FXXAYNDEKJJWOM-SWHLYJMESA-N |
| XLogP | 11.04 |
| TPSA | 111.83 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 655.85 |
| LogP ≤ 5 | 11.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'naphth_amino_B(25)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|