C32H29N7O3 — CID 163602814
2-[2-methyl-6-[[4-[[4-(2-nitroethyl)phenyl]diazenyl]naphthalen-1-yl]diazenyl]-1,3-dihydroperimidin-2-yl]ethanol (PubChem CID 163602814) has the molecular formula C32H29N7O3 and a molecular weight of 559.63 g/mol. Its IUPAC name is 2-[2-methyl-6-[[4-[[4-(2-nitroethyl)phenyl]diazenyl]naphthalen-1-yl]diazenyl]-1,3-dihydroperimidin-2-yl]ethanol.
| Compound Name | 2-[2-methyl-6-[[4-[[4-(2-nitroethyl)phenyl]diazenyl]naphthalen-1-yl]diazenyl]-1,3-dihydroperimidin-2-yl]ethanol |
|---|---|
| PubChem CID | 163602814 |
| Molecular Formula | C32H29N7O3 |
| Molecular Weight | 559.63 g/mol |
| Exact Mass | 559.23 |
| IUPAC Name | 2-[2-methyl-6-[[4-[[4-(2-nitroethyl)phenyl]diazenyl]naphthalen-1-yl]diazenyl]-1,3-dihydroperimidin-2-yl]ethanol |
| SMILES | CC1(CCO)Nc2cccc3c(/N=N/c4ccc(/N=N/c5ccc(CC[N+](=O)[O-])cc5)c5ccccc45)ccc(c23)N1 |
| InChI | InChI=1S/C32H29N7O3/c1-32(18-20-40)33-29-8-4-7-25-28(15-16-30(34-32)31(25)29)38-37-27-14-13-26(23-5-2-3-6-24(23)27)36-35-22-11-9-21(10-12-22)17-19-39(41)42/h2-16,33-34,40H,17-20H2,1H3/b36-35+,38-37+ |
| InChIKey | GZCXQIUJVLSJKA-JKWOPUAESA-N |
| XLogP | 8.58 |
| TPSA | 136.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.63 |
| LogP ≤ 5 | 8.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'naphth_amino_B(25)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|