C35H32N6O4 — CID 171843342
4-[2-[4-[[4-[(2,2-dimethyl-1,3-dihydroperimidin-6-yl)diazenyl]naphthalen-1-yl]diazenyl]phenyl]ethoxy]-4-oxobutanoic acid (PubChem CID 171843342) has the molecular formula C35H32N6O4 and a molecular weight of 600.68 g/mol. Its IUPAC name is 4-[2-[4-[[4-[(2,2-dimethyl-1,3-dihydroperimidin-6-yl)diazenyl]naphthalen-1-yl]diazenyl]phenyl]ethoxy]-4-oxobutanoic acid.
| Compound Name | 4-[2-[4-[[4-[(2,2-dimethyl-1,3-dihydroperimidin-6-yl)diazenyl]naphthalen-1-yl]diazenyl]phenyl]ethoxy]-4-oxobutanoic acid |
|---|---|
| PubChem CID | 171843342 |
| Molecular Formula | C35H32N6O4 |
| Molecular Weight | 600.68 g/mol |
| Exact Mass | 600.25 |
| IUPAC Name | 4-[2-[4-[[4-[(2,2-dimethyl-1,3-dihydroperimidin-6-yl)diazenyl]naphthalen-1-yl]diazenyl]phenyl]ethoxy]-4-oxobutanoic acid |
| SMILES | CC1(C)Nc2cccc3c(/N=N/c4ccc(/N=N/c5ccc(CCOC(=O)CCC(=O)O)cc5)c5ccccc45)ccc(c23)N1 |
| InChI | InChI=1S/C35H32N6O4/c1-35(2)36-30-9-5-8-26-29(16-17-31(37-35)34(26)30)41-40-28-15-14-27(24-6-3-4-7-25(24)28)39-38-23-12-10-22(11-13-23)20-21-45-33(44)19-18-32(42)43/h3-17,36-37H,18-21H2,1-2H3,(H,42,43)/b39-38+,41-40+ |
| InChIKey | FVCUDKJSDAVWRM-VJETXLNASA-N |
| XLogP | 9.35 |
| TPSA | 137.10 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.68 |
| LogP ≤ 5 | 9.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'naphth_amino_B(25)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|