C39H36N6O6 — CID 155216371
4-O-[[2-methyl-4-[(4-phenyldiazenylnaphthalen-1-yl)diazenyl]-1,3-dihydroperimidin-2-yl]methyl] 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] butanedioate (PubChem CID 155216371) has the molecular formula C39H36N6O6 and a molecular weight of 684.75 g/mol. Its IUPAC name is 4-O-[[2-methyl-4-[(4-phenyldiazenylnaphthalen-1-yl)diazenyl]-1,3-dihydroperimidin-2-yl]methyl] 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] butanedioate.
| Compound Name | 4-O-[[2-methyl-4-[(4-phenyldiazenylnaphthalen-1-yl)diazenyl]-1,3-dihydroperimidin-2-yl]methyl] 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] butanedioate |
|---|---|
| PubChem CID | 155216371 |
| Molecular Formula | C39H36N6O6 |
| Molecular Weight | 684.75 g/mol |
| Exact Mass | 684.27 |
| IUPAC Name | 4-O-[[2-methyl-4-[(4-phenyldiazenylnaphthalen-1-yl)diazenyl]-1,3-dihydroperimidin-2-yl]methyl] 1-O-[2-(2-methylprop-2-enoyloxy)ethyl] butanedioate |
| SMILES | C=C(C)C(=O)OCCOC(=O)CCC(=O)OCC1(C)Nc2cccc3ccc(/N=N/c4ccc(/N=N/c5ccccc5)c5ccccc45)c(c23)N1 |
| InChI | InChI=1S/C39H36N6O6/c1-25(2)38(48)50-23-22-49-34(46)20-21-35(47)51-24-39(3)40-32-15-9-10-26-16-17-33(37(41-39)36(26)32)45-44-31-19-18-30(28-13-7-8-14-29(28)31)43-42-27-11-5-4-6-12-27/h4-19,40-41H,1,20-24H2,2-3H3/b43-42+,45-44+ |
| InChIKey | IKVSPEHXGKJFQP-NITPHVIHSA-N |
| XLogP | 9.36 |
| TPSA | 152.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 51 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.75 |
| LogP ≤ 5 | 9.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'naphth_amino_B(25)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|