C39H39N3O6 — CID 140930625
3-[4-[[4-[4-[[4-[3-(2-methylprop-2-enoyloxy)propoxy]phenyl]diazenyl]phenyl]phenyl]methylideneamino]phenoxy]propyl 2-methylprop-2-enoate (PubChem CID 140930625) has the molecular formula C39H39N3O6 and a molecular weight of 645.76 g/mol. Its IUPAC name is 3-[4-[[4-[4-[[4-[3-(2-methylprop-2-enoyloxy)propoxy]phenyl]diazenyl]phenyl]phenyl]methylideneamino]phenoxy]propyl 2-methylprop-2-enoate.
| Compound Name | 3-[4-[[4-[4-[[4-[3-(2-methylprop-2-enoyloxy)propoxy]phenyl]diazenyl]phenyl]phenyl]methylideneamino]phenoxy]propyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 140930625 |
| Molecular Formula | C39H39N3O6 |
| Molecular Weight | 645.76 g/mol |
| Exact Mass | 645.28 |
| IUPAC Name | 3-[4-[[4-[4-[[4-[3-(2-methylprop-2-enoyloxy)propoxy]phenyl]diazenyl]phenyl]phenyl]methylideneamino]phenoxy]propyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCOc1ccc(/N=C/c2ccc(-c3ccc(/N=N/c4ccc(OCCCOC(=O)C(=C)C)cc4)cc3)cc2)cc1 |
| InChI | InChI=1S/C39H39N3O6/c1-28(2)38(43)47-25-5-23-45-36-19-15-33(16-20-36)40-27-30-7-9-31(10-8-30)32-11-13-34(14-12-32)41-42-35-17-21-37(22-18-35)46-24-6-26-48-39(44)29(3)4/h7-22,27H,1,3,5-6,23-26H2,2,4H3/b40-27+,42-41+ |
| InChIKey | NRZZHTSADBBOBE-KLNOVDEASA-N |
| XLogP | 9.30 |
| TPSA | 108.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 645.76 |
| LogP ≤ 5 | 9.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|