C36H34FNO7 — CID 58309105
[4-(4-cyano-3-fluorophenyl)-2-[methylperoxy(phenyl)methyl]phenyl] 4-[2-[(3-ethyloxetan-3-yl)methoxy]ethoxy]benzoate (PubChem CID 58309105) has the molecular formula C36H34FNO7 and a molecular weight of 611.67 g/mol. Its IUPAC name is [4-(4-cyano-3-fluorophenyl)-2-[methylperoxy(phenyl)methyl]phenyl] 4-[2-[(3-ethyloxetan-3-yl)methoxy]ethoxy]benzoate.
| Compound Name | [4-(4-cyano-3-fluorophenyl)-2-[methylperoxy(phenyl)methyl]phenyl] 4-[2-[(3-ethyloxetan-3-yl)methoxy]ethoxy]benzoate |
|---|---|
| PubChem CID | 58309105 |
| Molecular Formula | C36H34FNO7 |
| Molecular Weight | 611.67 g/mol |
| Exact Mass | 611.23 |
| IUPAC Name | [4-(4-cyano-3-fluorophenyl)-2-[methylperoxy(phenyl)methyl]phenyl] 4-[2-[(3-ethyloxetan-3-yl)methoxy]ethoxy]benzoate |
| SMILES | CCC1(COCCOc2ccc(C(=O)Oc3ccc(-c4ccc(C#N)c(F)c4)cc3C(OOC)c3ccccc3)cc2)COC1 |
| InChI | InChI=1S/C36H34FNO7/c1-3-36(23-42-24-36)22-41-17-18-43-30-14-11-26(12-15-30)35(39)44-33-16-13-27(28-9-10-29(21-38)32(37)20-28)19-31(33)34(45-40-2)25-7-5-4-6-8-25/h4-16,19-20,34H,3,17-18,22-24H2,1-2H3 |
| InChIKey | DAXLWWUYCLDLLV-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 96.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.67 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|