C48H44O18 — CID 174313957
bis[4-[4-(oxiran-2-ylmethoxy)benzoyl]oxy-3-(oxiran-2-ylmethoxycarbonyl)phenyl] cyclohexane-1,4-dicarboxylate (PubChem CID 174313957) has the molecular formula C48H44O18 and a molecular weight of 908.86 g/mol. Its IUPAC name is bis[4-[4-(oxiran-2-ylmethoxy)benzoyl]oxy-3-(oxiran-2-ylmethoxycarbonyl)phenyl] cyclohexane-1,4-dicarboxylate.
| Compound Name | bis[4-[4-(oxiran-2-ylmethoxy)benzoyl]oxy-3-(oxiran-2-ylmethoxycarbonyl)phenyl] cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 174313957 |
| Molecular Formula | C48H44O18 |
| Molecular Weight | 908.86 g/mol |
| Exact Mass | 908.25 |
| IUPAC Name | bis[4-[4-(oxiran-2-ylmethoxy)benzoyl]oxy-3-(oxiran-2-ylmethoxycarbonyl)phenyl] cyclohexane-1,4-dicarboxylate |
| SMILES | O=C(Oc1ccc(OC(=O)C2CCC(C(=O)Oc3ccc(OC(=O)c4ccc(OCC5CO5)cc4)c(C(=O)OCC4CO4)c3)CC2)cc1C(=O)OCC1CO1)c1ccc(OCC2CO2)cc1 |
| InChI | InChI=1S/C48H44O18/c49-43(63-33-13-15-41(39(17-33)47(53)61-25-37-23-59-37)65-45(51)29-5-9-31(10-6-29)55-19-35-21-57-35)27-1-2-28(4-3-27)44(50)64-34-14-16-42(40(18-34)48(54)62-26-38-24-60-38)66-46(52)30-7-11-32(12-8-30)56-20-36-22-58-36/h5-18,27-28,35-38H,1-4,19-26H2 |
| InChIKey | UCCFYSZQYLRCNA-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 226.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 908.86 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|