C22H20NO6+ — CID 23412525
(3,5-dicarboxyphenyl)-bis(4-methoxyphenyl)azanium (PubChem CID 23412525) has the molecular formula C22H20NO6+ and a molecular weight of 394.40 g/mol. Its IUPAC name is (3,5-dicarboxyphenyl)-bis(4-methoxyphenyl)azanium.
| Compound Name | (3,5-dicarboxyphenyl)-bis(4-methoxyphenyl)azanium |
|---|---|
| PubChem CID | 23412525 |
| Molecular Formula | C22H20NO6+ |
| Molecular Weight | 394.40 g/mol |
| Exact Mass | 394.13 |
| IUPAC Name | (3,5-dicarboxyphenyl)-bis(4-methoxyphenyl)azanium |
| SMILES | COc1ccc([NH+](c2ccc(OC)cc2)c2cc(C(=O)O)cc(C(=O)O)c2)cc1 |
| InChI | InChI=1S/C22H19NO6/c1-28-19-7-3-16(4-8-19)23(17-5-9-20(29-2)10-6-17)18-12-14(21(24)25)11-15(13-18)22(26)27/h3-13H,1-2H3,(H,24,25)(H,26,27)/p+1 |
| InChIKey | XDLJVEIVOZRLGG-UHFFFAOYSA-O |
| XLogP | 3.28 |
| TPSA | 97.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.40 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |