About (4-methoxyphenyl)methyliminocarbamothioic S-acid
(4-methoxyphenyl)methyliminocarbamothioic S-acid (PubChem CID 175036272) has the molecular formula C9H10N2O2S
and a molecular weight of 210.26 g/mol. Its IUPAC name is (4-methoxyphenyl)methyliminocarbamothioic S-acid.
Molecular Properties
| Compound Name | (4-methoxyphenyl)methyliminocarbamothioic S-acid |
| PubChem CID | 175036272 |
| Molecular Formula | C9H10N2O2S |
| Molecular Weight | 210.26 g/mol |
| Exact Mass | 210.05 |
| IUPAC Name | (4-methoxyphenyl)methyliminocarbamothioic S-acid |
| SMILES | COc1ccc(C/N=N/C(=O)S)cc1 |
| InChI | InChI=1S/C9H10N2O2S/c1-13-8-4-2-7(3-5-8)6-10-11-9(12)14/h2-5H,6H2,1H3,(H,12,14)/b11-10+ |
| InChIKey | OZKICTOFDYLSLV-ZHACJKMWSA-N |
| XLogP | 2.70 |
| TPSA | 51.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.26 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze (4-methoxyphenyl)methyliminocarbamothioic S-acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-methoxyphenyl)methyliminocarbamothioic S-acid?
The IUPAC name of (4-methoxyphenyl)methyliminocarbamothioic S-acid (CID 175036272) is (4-methoxyphenyl)methyliminocarbamothioic S-acid.
What is the SMILES notation for (4-methoxyphenyl)methyliminocarbamothioic S-acid?
The canonical SMILES for (4-methoxyphenyl)methyliminocarbamothioic S-acid is COc1ccc(C/N=N/C(=O)S)cc1.
What is the InChIKey of (4-methoxyphenyl)methyliminocarbamothioic S-acid?
The InChIKey is OZKICTOFDYLSLV-ZHACJKMWSA-N. The full InChI is InChI=1S/C9H10N2O2S/c1-13-8-4-2-7(3-5-8)6-10-11-9(12)14/h2-5H,6H2,1H3,(H,12,14)/b11-10+.
What are the key properties of (4-methoxyphenyl)methyliminocarbamothioic S-acid?
(4-methoxyphenyl)methyliminocarbamothioic S-acid has a molecular weight of 210.26 g/mol, XLogP of 2.70, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4-methoxyphenyl)methyliminocarbamothioic S-acid is sourced from PubChem (CID 175036272), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).