C25H30O5 — CID 10158493
4-[2-ethoxy-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)acetyl]oxybenzoic acid (PubChem CID 10158493) has the molecular formula C25H30O5 and a molecular weight of 410.51 g/mol. Its IUPAC name is 4-[2-ethoxy-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)acetyl]oxybenzoic acid.
| Compound Name | 4-[2-ethoxy-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)acetyl]oxybenzoic acid |
|---|---|
| PubChem CID | 10158493 |
| Molecular Formula | C25H30O5 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.21 |
| IUPAC Name | 4-[2-ethoxy-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)acetyl]oxybenzoic acid |
| SMILES | CCOC(C(=O)Oc1ccc(C(=O)O)cc1)c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C25H30O5/c1-6-29-21(23(28)30-18-10-7-16(8-11-18)22(26)27)17-9-12-19-20(15-17)25(4,5)14-13-24(19,2)3/h7-12,15,21H,6,13-14H2,1-5H3,(H,26,27) |
| InChIKey | NKUCRUYUGQPYQF-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|