C29H31BrO2 — CID 54421897
ethyl 2-(3-bromophenyl)-3-(5,5,8,8-tetramethyl-6,7-dihydroanthracen-2-yl)prop-2-enoate (PubChem CID 54421897) has the molecular formula C29H31BrO2 and a molecular weight of 491.47 g/mol. Its IUPAC name is ethyl 2-(3-bromophenyl)-3-(5,5,8,8-tetramethyl-6,7-dihydroanthracen-2-yl)prop-2-enoate.
| Compound Name | ethyl 2-(3-bromophenyl)-3-(5,5,8,8-tetramethyl-6,7-dihydroanthracen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 54421897 |
| Molecular Formula | C29H31BrO2 |
| Molecular Weight | 491.47 g/mol |
| Exact Mass | 490.15 |
| IUPAC Name | ethyl 2-(3-bromophenyl)-3-(5,5,8,8-tetramethyl-6,7-dihydroanthracen-2-yl)prop-2-enoate |
| SMILES | CCOC(=O)C(=Cc1ccc2cc3c(cc2c1)C(C)(C)CCC3(C)C)c1cccc(Br)c1 |
| InChI | InChI=1S/C29H31BrO2/c1-6-32-27(31)24(21-8-7-9-23(30)16-21)15-19-10-11-20-17-25-26(18-22(20)14-19)29(4,5)13-12-28(25,2)3/h7-11,14-18H,6,12-13H2,1-5H3 |
| InChIKey | WBKCWCNXWWBCSK-UHFFFAOYSA-N |
| XLogP | 8.06 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.47 |
| LogP ≤ 5 | 8.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|