C26H30O3 — CID 88629519
ethyl (E)-3-[4-(oxomethylidene)cyclohexa-1,5-dien-1-yl]-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-2-enoate (PubChem CID 88629519) has the molecular formula C26H30O3 and a molecular weight of 390.52 g/mol. Its IUPAC name is ethyl (E)-3-[4-(oxomethylidene)cyclohexa-1,5-dien-1-yl]-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-2-enoate.
| Compound Name | ethyl (E)-3-[4-(oxomethylidene)cyclohexa-1,5-dien-1-yl]-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-2-enoate |
|---|---|
| PubChem CID | 88629519 |
| Molecular Formula | C26H30O3 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.22 |
| IUPAC Name | ethyl (E)-3-[4-(oxomethylidene)cyclohexa-1,5-dien-1-yl]-2-(5,5,8,8-tetramethyl-6,7-dihydronaphthalen-2-yl)prop-2-enoate |
| SMILES | CCOC(=O)/C(=C/C1=CCC(=C=O)C=C1)c1ccc2c(c1)C(C)(C)CCC2(C)C |
| InChI | InChI=1S/C26H30O3/c1-6-29-24(28)21(15-18-7-9-19(17-27)10-8-18)20-11-12-22-23(16-20)26(4,5)14-13-25(22,2)3/h7-9,11-12,15-16H,6,10,13-14H2,1-5H3/b21-15+ |
| InChIKey | ZSSYAVGTSDRDKH-RCCKNPSSSA-N |
| XLogP | 5.63 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|