C10H7NO4 — CID 149463581
3-benzoyl-1,3-oxazolidine-2,5-dione (PubChem CID 149463581) has the molecular formula C10H7NO4 and a molecular weight of 205.17 g/mol. Its IUPAC name is 3-benzoyl-1,3-oxazolidine-2,5-dione.
| Compound Name | 3-benzoyl-1,3-oxazolidine-2,5-dione |
|---|---|
| PubChem CID | 149463581 |
| Molecular Formula | C10H7NO4 |
| Molecular Weight | 205.17 g/mol |
| Exact Mass | 205.04 |
| IUPAC Name | 3-benzoyl-1,3-oxazolidine-2,5-dione |
| SMILES | O=C1CN(C(=O)c2ccccc2)C(=O)O1 |
| InChI | InChI=1S/C10H7NO4/c12-8-6-11(10(14)15-8)9(13)7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | YZZKTUDRQPGKEL-UHFFFAOYSA-N |
| XLogP | 0.81 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.17 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|