C18H14N2O — CID 140991005
phenyl(4H-pyrrolo[1,2-a]quinoxalin-5-yl)methanone (PubChem CID 140991005) has the molecular formula C18H14N2O and a molecular weight of 274.32 g/mol. Its IUPAC name is phenyl(4H-pyrrolo[1,2-a]quinoxalin-5-yl)methanone.
| Compound Name | phenyl(4H-pyrrolo[1,2-a]quinoxalin-5-yl)methanone |
|---|---|
| PubChem CID | 140991005 |
| Molecular Formula | C18H14N2O |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.11 |
| IUPAC Name | phenyl(4H-pyrrolo[1,2-a]quinoxalin-5-yl)methanone |
| SMILES | O=C(c1ccccc1)N1Cc2cccn2-c2ccccc21 |
| InChI | InChI=1S/C18H14N2O/c21-18(14-7-2-1-3-8-14)20-13-15-9-6-12-19(15)16-10-4-5-11-17(16)20/h1-12H,13H2 |
| InChIKey | WGKHQHCCWCJQRZ-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 25.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |