C16H22N2O4S — CID 97387574
N-[(4aS,8R,8aS)-6-benzoyl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]methanesulfonamide (PubChem CID 97387574) has the molecular formula C16H22N2O4S and a molecular weight of 338.43 g/mol. Its IUPAC name is N-[(4aS,8R,8aS)-6-benzoyl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]methanesulfonamide.
| Compound Name | N-[(4aS,8R,8aS)-6-benzoyl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]methanesulfonamide |
|---|---|
| PubChem CID | 97387574 |
| Molecular Formula | C16H22N2O4S |
| Molecular Weight | 338.43 g/mol |
| Exact Mass | 338.13 |
| IUPAC Name | N-[(4aS,8R,8aS)-6-benzoyl-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)N[C@@H]1CN(C(=O)c2ccccc2)C[C@@H]2CCCO[C@@H]21 |
| InChI | InChI=1S/C16H22N2O4S/c1-23(20,21)17-14-11-18(10-13-8-5-9-22-15(13)14)16(19)12-6-3-2-4-7-12/h2-4,6-7,13-15,17H,5,8-11H2,1H3/t13-,14+,15-/m0/s1 |
| InChIKey | JEIGBGRCHRKRQG-ZNMIVQPWSA-N |
| XLogP | 0.86 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.43 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |