C16H19N3O4S — CID 97386989
N-[(3R,3aS,7aR)-1-(3-cyanobenzoyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]methanesulfonamide (PubChem CID 97386989) has the molecular formula C16H19N3O4S and a molecular weight of 349.41 g/mol. Its IUPAC name is N-[(3R,3aS,7aR)-1-(3-cyanobenzoyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]methanesulfonamide.
| Compound Name | N-[(3R,3aS,7aR)-1-(3-cyanobenzoyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]methanesulfonamide |
|---|---|
| PubChem CID | 97386989 |
| Molecular Formula | C16H19N3O4S |
| Molecular Weight | 349.41 g/mol |
| Exact Mass | 349.11 |
| IUPAC Name | N-[(3R,3aS,7aR)-1-(3-cyanobenzoyl)-3,3a,5,6,7,7a-hexahydro-2H-pyrano[3,2-b]pyrrol-3-yl]methanesulfonamide |
| SMILES | CS(=O)(=O)N[C@@H]1CN(C(=O)c2cccc(C#N)c2)[C@@H]2CCCO[C@@H]21 |
| InChI | InChI=1S/C16H19N3O4S/c1-24(21,22)18-13-10-19(14-6-3-7-23-15(13)14)16(20)12-5-2-4-11(8-12)9-17/h2,4-5,8,13-15,18H,3,6-7,10H2,1H3/t13-,14-,15-/m1/s1 |
| InChIKey | NDLJBDJWYWAGJT-RBSFLKMASA-N |
| XLogP | 0.48 |
| TPSA | 99.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.41 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |