C17H23NO4S — CID 54099582
[(4aS,8aS)-2-benzoyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-6-yl] methanesulfonate (PubChem CID 54099582) has the molecular formula C17H23NO4S and a molecular weight of 337.44 g/mol. Its IUPAC name is [(4aS,8aS)-2-benzoyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-6-yl] methanesulfonate.
| Compound Name | [(4aS,8aS)-2-benzoyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-6-yl] methanesulfonate |
|---|---|
| PubChem CID | 54099582 |
| Molecular Formula | C17H23NO4S |
| Molecular Weight | 337.44 g/mol |
| Exact Mass | 337.13 |
| IUPAC Name | [(4aS,8aS)-2-benzoyl-3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-6-yl] methanesulfonate |
| SMILES | CS(=O)(=O)OC1CC[C@@H]2CN(C(=O)c3ccccc3)CC[C@H]2C1 |
| InChI | InChI=1S/C17H23NO4S/c1-23(20,21)22-16-8-7-15-12-18(10-9-14(15)11-16)17(19)13-5-3-2-4-6-13/h2-6,14-16H,7-12H2,1H3/t14-,15+,16?/m0/s1 |
| InChIKey | MZPOTPHEMWOEFI-QMRHZFGWSA-N |
| XLogP | 2.29 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.44 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|