C12H13N3O8S — CID 76732378
[1-(3,5-dinitrobenzoyl)pyrrolidin-3-yl] methanesulfonate (PubChem CID 76732378) has the molecular formula C12H13N3O8S and a molecular weight of 359.32 g/mol. Its IUPAC name is [1-(3,5-dinitrobenzoyl)pyrrolidin-3-yl] methanesulfonate.
| Compound Name | [1-(3,5-dinitrobenzoyl)pyrrolidin-3-yl] methanesulfonate |
|---|---|
| PubChem CID | 76732378 |
| Molecular Formula | C12H13N3O8S |
| Molecular Weight | 359.32 g/mol |
| Exact Mass | 359.04 |
| IUPAC Name | [1-(3,5-dinitrobenzoyl)pyrrolidin-3-yl] methanesulfonate |
| SMILES | CS(=O)(=O)OC1CCN(C(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)C1 |
| InChI | InChI=1S/C12H13N3O8S/c1-24(21,22)23-11-2-3-13(7-11)12(16)8-4-9(14(17)18)6-10(5-8)15(19)20/h4-6,11H,2-3,7H2,1H3 |
| InChIKey | OWEVCZJORNSBDT-UHFFFAOYSA-N |
| XLogP | 0.69 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.32 |
| LogP ≤ 5 | 0.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|