C12H15N3O8S2 — CID 158143315
[(3S)-1-(3,5-dinitrobenzoyl)pyrrolidin-3-yl] methanesulfonate;sulfane (PubChem CID 158143315) has the molecular formula C12H15N3O8S2 and a molecular weight of 393.40 g/mol. Its IUPAC name is [(3S)-1-(3,5-dinitrobenzoyl)pyrrolidin-3-yl] methanesulfonate;sulfane.
| Compound Name | [(3S)-1-(3,5-dinitrobenzoyl)pyrrolidin-3-yl] methanesulfonate;sulfane |
|---|---|
| PubChem CID | 158143315 |
| Molecular Formula | C12H15N3O8S2 |
| Molecular Weight | 393.40 g/mol |
| Exact Mass | 393.03 |
| IUPAC Name | [(3S)-1-(3,5-dinitrobenzoyl)pyrrolidin-3-yl] methanesulfonate;sulfane |
| SMILES | CS(=O)(=O)O[C@H]1CCN(C(=O)c2cc([N+](=O)[O-])cc([N+](=O)[O-])c2)C1.S |
| InChI | InChI=1S/C12H13N3O8S.H2S/c1-24(21,22)23-11-2-3-13(7-11)12(16)8-4-9(14(17)18)6-10(5-8)15(19)20;/h4-6,11H,2-3,7H2,1H3;1H2/t11-;/m0./s1 |
| InChIKey | FUFCKFOIELLIAZ-MERQFXBCSA-N |
| XLogP | 0.81 |
| TPSA | 149.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.40 |
| LogP ≤ 5 | 0.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|