C21H24N4O7 — CID 159792863
N-[4-[1-(3,5-dinitrobenzoyl)piperidin-4-yl]oxyphenyl]acetamide;methane (PubChem CID 159792863) has the molecular formula C21H24N4O7 and a molecular weight of 444.44 g/mol. Its IUPAC name is N-[4-[1-(3,5-dinitrobenzoyl)piperidin-4-yl]oxyphenyl]acetamide;methane.
| Compound Name | N-[4-[1-(3,5-dinitrobenzoyl)piperidin-4-yl]oxyphenyl]acetamide;methane |
|---|---|
| PubChem CID | 159792863 |
| Molecular Formula | C21H24N4O7 |
| Molecular Weight | 444.44 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | N-[4-[1-(3,5-dinitrobenzoyl)piperidin-4-yl]oxyphenyl]acetamide;methane |
| SMILES | C.CC(=O)Nc1ccc(OC2CCN(C(=O)c3cc([N+](=O)[O-])cc([N+](=O)[O-])c3)CC2)cc1 |
| InChI | InChI=1S/C20H20N4O7.CH4/c1-13(25)21-15-2-4-18(5-3-15)31-19-6-8-22(9-7-19)20(26)14-10-16(23(27)28)12-17(11-14)24(29)30;/h2-5,10-12,19H,6-9H2,1H3,(H,21,25);1H4 |
| InChIKey | NIUFOLINRPNDLB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 144.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|