C28H35I2N3O5S — CID 158534156
[(3R)-1-(4-iodobenzoyl)pyrrolidin-3-yl] methanesulfonate;(4-iodophenyl)-[(3S)-3-piperidin-1-ylpyrrolidin-1-yl]methanone (PubChem CID 158534156) has the molecular formula C28H35I2N3O5S and a molecular weight of 779.48 g/mol. Its IUPAC name is [(3R)-1-(4-iodobenzoyl)pyrrolidin-3-yl] methanesulfonate;(4-iodophenyl)-[(3S)-3-piperidin-1-ylpyrrolidin-1-yl]methanone.
| Compound Name | [(3R)-1-(4-iodobenzoyl)pyrrolidin-3-yl] methanesulfonate;(4-iodophenyl)-[(3S)-3-piperidin-1-ylpyrrolidin-1-yl]methanone |
|---|---|
| PubChem CID | 158534156 |
| Molecular Formula | C28H35I2N3O5S |
| Molecular Weight | 779.48 g/mol |
| Exact Mass | 779.04 |
| IUPAC Name | [(3R)-1-(4-iodobenzoyl)pyrrolidin-3-yl] methanesulfonate;(4-iodophenyl)-[(3S)-3-piperidin-1-ylpyrrolidin-1-yl]methanone |
| SMILES | CS(=O)(=O)O[C@@H]1CCN(C(=O)c2ccc(I)cc2)C1.O=C(c1ccc(I)cc1)N1CC[C@H](N2CCCCC2)C1 |
| InChI | InChI=1S/C16H21IN2O.C12H14INO4S/c17-14-6-4-13(5-7-14)16(20)19-11-8-15(12-19)18-9-2-1-3-10-18;1-19(16,17)18-11-6-7-14(8-11)12(15)9-2-4-10(13)5-3-9/h4-7,15H,1-3,8-12H2;2-5,11H,6-8H2,1H3/t15-;11-/m01/s1 |
| InChIKey | HNSUQOZBGPHRSW-XVNZDIRASA-N |
| XLogP | 4.47 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 779.48 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|