C14H21N3O5S — CID 97411344
N-[(4aS,8R,8aS)-6-(5-methyl-1,2-oxazole-4-carbonyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]methanesulfonamide (PubChem CID 97411344) has the molecular formula C14H21N3O5S and a molecular weight of 343.41 g/mol. Its IUPAC name is N-[(4aS,8R,8aS)-6-(5-methyl-1,2-oxazole-4-carbonyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]methanesulfonamide.
| Compound Name | N-[(4aS,8R,8aS)-6-(5-methyl-1,2-oxazole-4-carbonyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]methanesulfonamide |
|---|---|
| PubChem CID | 97411344 |
| Molecular Formula | C14H21N3O5S |
| Molecular Weight | 343.41 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | N-[(4aS,8R,8aS)-6-(5-methyl-1,2-oxazole-4-carbonyl)-2,3,4,4a,5,7,8,8a-octahydropyrano[3,2-c]pyridin-8-yl]methanesulfonamide |
| SMILES | Cc1oncc1C(=O)N1C[C@@H]2CCCO[C@@H]2[C@H](NS(C)(=O)=O)C1 |
| InChI | InChI=1S/C14H21N3O5S/c1-9-11(6-15-22-9)14(18)17-7-10-4-3-5-21-13(10)12(8-17)16-23(2,19)20/h6,10,12-13,16H,3-5,7-8H2,1-2H3/t10-,12+,13-/m0/s1 |
| InChIKey | SUYDRUQSVOWNPG-UHTWSYAYSA-N |
| XLogP | 0.15 |
| TPSA | 101.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.41 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |