C23H28N2O2 — CID 167817879
[3-(4-aminooxan-2-yl)piperidin-1-yl]-(4-phenylphenyl)methanone (PubChem CID 167817879) has the molecular formula C23H28N2O2 and a molecular weight of 364.49 g/mol. Its IUPAC name is [3-(4-aminooxan-2-yl)piperidin-1-yl]-(4-phenylphenyl)methanone.
| Compound Name | [3-(4-aminooxan-2-yl)piperidin-1-yl]-(4-phenylphenyl)methanone |
|---|---|
| PubChem CID | 167817879 |
| Molecular Formula | C23H28N2O2 |
| Molecular Weight | 364.49 g/mol |
| Exact Mass | 364.22 |
| IUPAC Name | [3-(4-aminooxan-2-yl)piperidin-1-yl]-(4-phenylphenyl)methanone |
| SMILES | NC1CCOC(C2CCCN(C(=O)c3ccc(-c4ccccc4)cc3)C2)C1 |
| InChI | InChI=1S/C23H28N2O2/c24-21-12-14-27-22(15-21)20-7-4-13-25(16-20)23(26)19-10-8-18(9-11-19)17-5-2-1-3-6-17/h1-3,5-6,8-11,20-22H,4,7,12-16,24H2 |
| InChIKey | PUFWZWXBEBAAQI-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 55.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.49 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |