C25H28N4O — CID 16613326
(4-phenylphenyl)-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone (PubChem CID 16613326) has the molecular formula C25H28N4O and a molecular weight of 400.53 g/mol. Its IUPAC name is (4-phenylphenyl)-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone.
| Compound Name | (4-phenylphenyl)-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone |
|---|---|
| PubChem CID | 16613326 |
| Molecular Formula | C25H28N4O |
| Molecular Weight | 400.53 g/mol |
| Exact Mass | 400.23 |
| IUPAC Name | (4-phenylphenyl)-[3-(6,7,8,9-tetrahydro-5H-[1,2,4]triazolo[4,3-a]azepin-3-yl)piperidin-1-yl]methanone |
| SMILES | O=C(c1ccc(-c2ccccc2)cc1)N1CCCC(c2nnc3n2CCCCC3)C1 |
| InChI | InChI=1S/C25H28N4O/c30-25(21-14-12-20(13-15-21)19-8-3-1-4-9-19)28-16-7-10-22(18-28)24-27-26-23-11-5-2-6-17-29(23)24/h1,3-4,8-9,12-15,22H,2,5-7,10-11,16-18H2 |
| InChIKey | WVNFQRODBNEJEK-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 51.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.53 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |